2058-74-4 1-Methylisatin
Naam product |
1-Methylisatin |
Engelse naam |
1-Methylisatin; Methylisatintech; 1-methyl-2,3-dihydroindole-2,3-dione; N-Methylsatin; 1-Methyl-2,3-indolinedione; 1-methyl-1H-indole-2,3-dione; 1-Methylindoline-2,3-Dione |
MF |
C9H7NO2 |
Molecuulgewicht |
161.1574 |
InChI |
InChI=1/C9H7NO2/c1-10-7-5-3-2-4-6(7)8(11)9(10)12/h2-5H,1H3 |
CAS-nummer |
2058-74-4 |
EINECS |
218-164-9 |
Moleculaire Structuur |
|
Dichtheid |
1.314g/cm3 |
Smeltpunt |
129-133℃ |
Kookpunt |
294.3°C at 760 mmHg |
Brekingsindex |
1.607 |
Vlampunt |
137.4°C |
Dampdruk |
0.00164mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|