ChemNet > CAS > 206551-43-1 5-Acetylthiophene-2-boronic acid
206551-43-1 5-Acetylthiophene-2-boronic acid
Naam product |
5-Acetylthiophene-2-boronic acid |
Engelse naam |
5-Acetylthiophene-2-boronic acid; (5-acetylthiophen-2-yl)boronic acid; 5-Acetyl-2-thiopheneboronic acid; 2-Acetylthiphene-2-boronic acid; 2-ACETYLTHIOPHENE-5-BORONIC ACID; 5-Acetyl-2-thienylboronicAcid; 5-Acetylthiophen-2-Ylboronic Acid |
MF |
C6H7BO3S |
Molecuulgewicht |
169.994 |
InChI |
InChI=1/C6H7BO3S/c1-4(8)5-2-3-6(11-5)7(9)10/h2-3,9-10H,1H3 |
CAS-nummer |
206551-43-1 |
Moleculaire Structuur |
|
Dichtheid |
1.34g/cm3 |
Smeltpunt |
133-138℃ |
Kookpunt |
399.3°C at 760 mmHg |
Brekingsindex |
1.556 |
Vlampunt |
195.3°C |
Dampdruk |
4.29E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|