ChemNet > CAS > 215453-51-3 7-Bromo-1-chloroisoquinoline
215453-51-3 7-Bromo-1-chloroisoquinoline
| Naam product |
7-Bromo-1-chloroisoquinoline |
| Engelse naam |
7-Bromo-1-chloroisoquinoline; 1-Chloro-7-bromoisoquinoline |
| MF |
C9H5BrClN |
| Molecuulgewicht |
242.4997 |
| InChI |
InChI=1/C9H5BrClN/c10-7-2-1-6-3-4-12-9(11)8(6)5-7/h1-5H |
| CAS-nummer |
215453-51-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.673g/cm3 |
| Kookpunt |
349.497°C at 760 mmHg |
| Brekingsindex |
1.68 |
| Vlampunt |
165.17°C |
| Dampdruk |
0mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
