2157-52-0 9-Fluorenone Oxime
Naam product |
9-Fluorenone Oxime |
Engelse naam |
9-Fluorenone Oxime;Fluorenone oxime; 4-07-00-01631 (Beilstein Handbook Reference); 9-Oximinofluorene; 9H-Fluoren-9-one, oxime; BRN 1871046; Fluorenone-9-oxime; NSC 1988; 9H-Fluoren-9-one oxime; Fluoren-9-one, oxime; N-hydroxy-9H-fluoren-9-imine |
MF |
C13H9NO |
Molecuulgewicht |
195.2167 |
InChI |
InChI=1/C13H9NO/c15-14-13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13/h1-8,15H |
CAS-nummer |
2157-52-0 |
EINECS |
218-471-8 |
Moleculaire Structuur |
|
Dichtheid |
1.23g/cm3 |
Kookpunt |
394.1°C at 760 mmHg |
Brekingsindex |
1.663 |
Vlampunt |
252.2°C |
Dampdruk |
6.45E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|