ChemNet > CAS > 2160-94-3 3-Cyclohexene-1,1-dimethanol
2160-94-3 3-Cyclohexene-1,1-dimethanol
Naam product |
3-Cyclohexene-1,1-dimethanol |
Engelse naam |
3-Cyclohexene-1,1-dimethanol; 4,4-Bis(hydroxymethyl)-1-cyclohexene; cyclohex-3-ene-1,1-diyldimethanol |
MF |
C8H14O2 |
Molecuulgewicht |
142.1956 |
InChI |
InChI=1/C8H14O2/c9-6-8(7-10)4-2-1-3-5-8/h1-2,9-10H,3-7H2 |
CAS-nummer |
2160-94-3 |
EINECS |
218-481-2 |
Moleculaire Structuur |
|
Dichtheid |
1.05g/cm3 |
Smeltpunt |
88-92℃ |
Kookpunt |
231.2°C at 760 mmHg |
Brekingsindex |
1.497 |
Vlampunt |
105°C |
Dampdruk |
0.0119mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|