ChemNet > CAS > 2164-33-2 2-Chloromethyl-1,4-benzodioxane
2164-33-2 2-Chloromethyl-1,4-benzodioxane
| Naam product |
2-Chloromethyl-1,4-benzodioxane |
| Engelse naam |
2-Chloromethyl-1,4-benzodioxane; 2-(Chloromethyl)-2,3-dihydro-1,4-benzodioxine; 2-(chloromethyl)-2,3-dihydrobenzo[b][1,4]dioxine;
|
| MF |
C9H9ClO2 |
| Molecuulgewicht |
184.6196 |
| InChI |
InChI=1/C9H9ClO2/c10-5-7-6-11-8-3-1-2-4-9(8)12-7/h1-4,7H,5-6H2 |
| CAS-nummer |
2164-33-2 |
| EINECS |
218-502-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.224g/cm3 |
| Kookpunt |
270.1°C at 760 mmHg |
| Brekingsindex |
1.529 |
| Vlampunt |
114.3°C |
| Dampdruk |
0.0116mmHg at 25°C |
| Gevaarsymbolen |
 C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
