ChemNet > CAS > 2177-70-0 Phenyl Methacrylate
2177-70-0 Phenyl Methacrylate
| Naam product |
Phenyl Methacrylate |
| Engelse naam |
Phenyl Methacrylate; Phenyl
methacrylate, (Methacrylic acid phenyl ester); Methacrylic acid phenyl ester; phenyl 2-methylprop-2-enoate |
| MF |
C10H10O2 |
| Molecuulgewicht |
162.1852 |
| InChI |
InChI=1/C10H10O2/c1-8(2)10(11)12-9-6-4-3-5-7-9/h3-7H,1H2,2H3 |
| CAS-nummer |
2177-70-0 |
| EINECS |
218-542-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.046g/cm3 |
| Kookpunt |
249.3°C at 760 mmHg |
| Brekingsindex |
1.511 |
| Vlampunt |
97.1°C |
| Dampdruk |
0.0231mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
