ChemNet > CAS > 2184-88-5 4-chloor-alfa-methylfenylacetonitril
2184-88-5 4-chloor-alfa-methylfenylacetonitril
| Naam product |
4-chloor-alfa-methylfenylacetonitril |
| Synoniemen |
2-(p-chloorfenyl)propionitril; 2-(4-chloorfenyl)propaannitril |
| Engelse naam |
4-Chloro-alpha-methylphenylacetonitrile; 2-(p-Chlorophenyl)propionitrile; 2-(4-chlorophenyl)propanenitrile |
| MF |
C9H8ClN |
| Molecuulgewicht |
165.6195 |
| InChI |
InChI=1/C9H8ClN/c1-7(6-11)8-2-4-9(10)5-3-8/h2-5,7H,1H3 |
| CAS-nummer |
2184-88-5 |
| EINECS |
218-569-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.143g/cm3 |
| Kookpunt |
260.3°C at 760 mmHg |
| Brekingsindex |
1.537 |
| Vlampunt |
104°C |
| Dampdruk |
0.0123mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37:Wear suitable protective clothing and gloves.;
|
|
