ChemNet > CAS > 2196-13-6 Thioisonicotinamide
2196-13-6 Thioisonicotinamide
| Naam product |
Thioisonicotinamide |
| Engelse naam |
Thioisonicotinamide; isonicotinthioamide; Isothionicotinamide; Pyridine-4-thiocarboxamide; pyridine-4-carbothioamide |
| MF |
C6H6N2S |
| Molecuulgewicht |
138.1902 |
| InChI |
InChI=1/C6H6N2S/c7-6(9)5-1-3-8-4-2-5/h1-4H,(H2,7,9) |
| CAS-nummer |
2196-13-6 |
| EINECS |
218-592-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.265g/cm3 |
| Smeltpunt |
198-202℃ |
| Kookpunt |
278.9°C at 760 mmHg |
| Brekingsindex |
1.664 |
| Vlampunt |
122.5°C |
| Dampdruk |
0.00415mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
