ChemNet > CAS > 2198-53-0 2',6'-Dimethylacetanilide
2198-53-0 2',6'-Dimethylacetanilide
Naam product |
2',6'-Dimethylacetanilide |
Engelse naam |
2',6'-Dimethylacetanilide; 2,6-Acetoxylidide; N-(2,6-Dimethylphenyl)acetamide |
MF |
C10H13NO |
Molecuulgewicht |
163.2163 |
InChI |
InChI=1/C10H13NO/c1-7-5-4-6-8(2)10(7)11-9(3)12/h4-6H,1-3H3,(H,11,12) |
CAS-nummer |
2198-53-0 |
EINECS |
218-596-8 |
Moleculaire Structuur |
|
Dichtheid |
1.052g/cm3 |
Smeltpunt |
178-184℃ |
Kookpunt |
282.6°C at 760 mmHg |
Brekingsindex |
1.56 |
Vlampunt |
163°C |
Dampdruk |
0.00332mmHg at 25°C |
Gevaarsymbolen |
Xn:Harmful;
|
Risico-codes |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|