ChemNet > CAS > 220141-73-1 3,4,5-trifluoroacetophenone
220141-73-1 3,4,5-trifluoroacetophenone
| Naam product |
3,4,5-trifluoroacetophenone |
| Engelse naam |
3,4,5-trifluoroacetophenone; 3',4',5'-Trifluoroacetophenone; 1-(3,4,5-trifluorophenyl)ethanone |
| MF |
C8H5F3O |
| Molecuulgewicht |
174.1199 |
| InChI |
InChI=1/C8H5F3O/c1-4(12)5-2-6(9)8(11)7(10)3-5/h2-3H,1H3 |
| CAS-nummer |
220141-73-1 |
| Moleculaire Structuur |
|
| Dichtheid |
1.303g/cm3 |
| Kookpunt |
208.8°C at 760 mmHg |
| Brekingsindex |
1.455 |
| Vlampunt |
72.5°C |
| Dampdruk |
0.209mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
