ChemNet > CAS > 22135-50-8 4-(4-methoxyphenyl)-1-butanol
22135-50-8;52244-70-9 4-(4-methoxyphenyl)-1-butanol
Naam product |
4-(4-methoxyphenyl)-1-butanol |
Engelse naam |
4-(4-methoxyphenyl)-1-butanol; 4-(4-methoxyphenyl)butan-1-ol; 1-(4-methoxyphenyl)butan-1-ol |
MF |
C11H16O2 |
Molecuulgewicht |
180.2435 |
InChI |
InChI=1/C11H16O2/c1-13-11-7-5-10(6-8-11)4-2-3-9-12/h5-8,12H,2-4,9H2,1H3 |
CAS-nummer |
22135-50-8;52244-70-9 |
EINECS |
257-782-3 |
Moleculaire Structuur |
|
Dichtheid |
1.019g/cm3 |
Smeltpunt |
3-4℃ |
Kookpunt |
304.7°C at 760 mmHg |
Brekingsindex |
1.514 |
Vlampunt |
130.9°C |
Dampdruk |
0.000377mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|