ChemNet > CAS > 2216-94-6 Ethyl phenylpropiolate
2216-94-6 Ethyl phenylpropiolate
| Naam product |
Ethyl phenylpropiolate |
| Engelse naam |
Ethyl phenylpropiolate; Ethyl phenylacetylenecarboxylate~Phenylpropiolic acid ethyl ester; ethyl 3-phenylprop-2-ynoate |
| MF |
C11H10O2 |
| Molecuulgewicht |
174.1959 |
| InChI |
InChI=1/C11H10O2/c1-2-13-11(12)9-8-10-6-4-3-5-7-10/h3-7H,2H2,1H3 |
| CAS-nummer |
2216-94-6 |
| EINECS |
218-703-8 |
| Moleculaire Structuur |
|
| Dichtheid |
1.09g/cm3 |
| Kookpunt |
265°C at 760 mmHg |
| Brekingsindex |
1.538 |
| Vlampunt |
124.9°C |
| Dampdruk |
0.0094mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
