ChemNet > CAS > 22395-24-0 3',4',7-Trimethoxyflavone
22395-24-0 3',4',7-Trimethoxyflavone
Naam product |
3',4',7-Trimethoxyflavone |
Engelse naam |
3',4',7-Trimethoxyflavone;7,3',4'-Trimethoxyflavone; 2-(3,4-Dimethoxyphenyl)-7-methoxy-4H-1-benzopyran-4-one; 4H-1-Benzopyran-4-one, 2-(3,4-dimethoxyphenyl)-7-methoxy-; 2-(3,4-dimethoxyphenyl)-7-methoxy-4H-chromen-4-one |
MF |
C18H16O5 |
Molecuulgewicht |
312.3166 |
InChI |
InChI=1/C18H16O5/c1-20-12-5-6-13-14(19)10-16(23-17(13)9-12)11-4-7-15(21-2)18(8-11)22-3/h4-10H,1-3H3 |
CAS-nummer |
22395-24-0 |
Moleculaire Structuur |
|
Dichtheid |
1.242g/cm3 |
Kookpunt |
477.4°C at 760 mmHg |
Brekingsindex |
1.585 |
Vlampunt |
212°C |
Dampdruk |
2.81E-09mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|