ChemNet > CAS > 2254-94-6 N-methylbenzothiazool-2-thion
2254-94-6 N-methylbenzothiazool-2-thion
Naam product |
N-methylbenzothiazool-2-thion |
Synoniemen |
3-methylbenzothiazool-2-thion; 3-methyl-1,3-benzothiazool-2(3H)-thion |
Engelse naam |
N-Methylbenzothiazole-2-thione; 3-Methylbenzothiazole-2-thione; 3-methyl-1,3-benzothiazole-2(3H)-thione |
MF |
C8H7NS2 |
Molecuulgewicht |
181.2779 |
InChI |
InChI=1/C8H7NS2/c1-9-6-4-2-3-5-7(6)11-8(9)10/h2-5H,1H3 |
CAS-nummer |
2254-94-6 |
EINECS |
218-852-9 |
Moleculaire Structuur |
|
Dichtheid |
1.39g/cm3 |
Smeltpunt |
88-91℃ |
Kookpunt |
300.6°C at 760 mmHg |
Brekingsindex |
1.753 |
Vlampunt |
135.6°C |
Dampdruk |
0.00111mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|