ChemNet > CAS > 22625-57-6 5-Chloromethyl-2-oxazolidinone
22625-57-6 5-Chloromethyl-2-oxazolidinone
| Naam product |
5-Chloromethyl-2-oxazolidinone |
| Engelse naam |
5-Chloromethyl-2-oxazolidinone; 5-Chloromethyloxazolidin-2-one; 5-(chloromethyl)-1,3-oxazolidin-2-one; (5R)-5-(chloromethyl)-1,3-oxazolidin-2-one; (5S)-5-(chloromethyl)-1,3-oxazolidin-2-one |
| MF |
C4H6ClNO2 |
| Molecuulgewicht |
135.5489 |
| InChI |
InChI=1/C4H6ClNO2/c5-1-3-2-6-4(7)8-3/h3H,1-2H2,(H,6,7)/t3-/m1/s1 |
| CAS-nummer |
22625-57-6 |
| EINECS |
245-137-9 |
| Moleculaire Structuur |
|
| Dichtheid |
1.294g/cm3 |
| Smeltpunt |
101-105℃ |
| Kookpunt |
382.8°C at 760 mmHg |
| Brekingsindex |
1.455 |
| Vlampunt |
185.3°C |
| Dampdruk |
4.6E-06mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
