ChemNet > CAS > 2265-91-0 1,3-Difluoro-5-iodobenzene
2265-91-0 1,3-Difluoro-5-iodobenzene
Naam product |
1,3-Difluoro-5-iodobenzene |
Engelse naam |
1,3-Difluoro-5-iodobenzene; 3,5-DIFLUOROIODOBENZENE; 3,5-Difluoro iodobenzene |
MF |
C6H3F2I |
Molecuulgewicht |
239.9893 |
InChI |
InChI=1/C6H3F2I/c7-4-1-5(8)3-6(9)2-4/h1-3H |
CAS-nummer |
2265-91-0 |
Moleculaire Structuur |
|
Dichtheid |
2.001g/cm3 |
Kookpunt |
173.9°C at 760 mmHg |
Brekingsindex |
1.566 |
Vlampunt |
63.8°C |
Dampdruk |
1.66mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|