ChemNet > CAS > 2274-89-7 5-chloro-4-nitro-2,1,3-benzothiadiazole
2274-89-7 5-chloro-4-nitro-2,1,3-benzothiadiazole
Naam product |
5-chloro-4-nitro-2,1,3-benzothiadiazole |
Engelse naam |
5-chloro-4-nitro-2,1,3-benzothiadiazole;5-Chloro-4-(hydroxy(oxido)amino)-2,1,3-benzothiadiazole; NSC 202425 |
MF |
C6H2ClN3O2S |
Molecuulgewicht |
215.617 |
InChI |
InChI=1/C6H2ClN3O2S/c7-3-1-2-4-5(9-13-8-4)6(3)10(11)12/h1-2H |
CAS-nummer |
2274-89-7 |
Moleculaire Structuur |
|
Dichtheid |
1.749g/cm3 |
Smeltpunt |
149℃ |
Kookpunt |
348.8°C at 760 mmHg |
Brekingsindex |
1.747 |
Vlampunt |
164.7°C |
Dampdruk |
9.9E-05mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|