ChemNet > CAS > 22921-68-2 2-Bromo-5-methoxybenzoic acid
22921-68-2 2-Bromo-5-methoxybenzoic acid
| Naam product |
2-Bromo-5-methoxybenzoic acid |
| Engelse naam |
2-Bromo-5-methoxybenzoic acid; 6-Bromo-m-anisic acid; 2-bromo-5-methoxybenzoate |
| MF |
C8H6BrO3 |
| Molecuulgewicht |
230.036 |
| InChI |
InChI=1/C8H7BrO3/c1-12-5-2-3-7(9)6(4-5)8(10)11/h2-4H,1H3,(H,10,11)/p-1 |
| CAS-nummer |
22921-68-2 |
| EINECS |
245-329-2 |
| Moleculaire Structuur |
|
| Smeltpunt |
158-159℃ |
| Kookpunt |
337.8°C at 760 mmHg |
| Vlampunt |
158.1°C |
| Dampdruk |
4E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
