ChemNet > CAS > 23023-13-4 1-(3,4-Methylenedioxy)phenyl-2-butanone
23023-13-4 1-(3,4-Methylenedioxy)phenyl-2-butanone
Naam product |
1-(3,4-Methylenedioxy)phenyl-2-butanone |
Engelse naam |
1-(3,4-Methylenedioxy)phenyl-2-butanone; 1-(1,3-Benzodioxol-5-yl)-2-butanone~Ethyl piperonyl ketone; 1-(1,3-benzodioxol-5-yl)butan-2-one |
MF |
C11H12O3 |
Molecuulgewicht |
192.2112 |
InChI |
InChI=1/C11H12O3/c1-2-9(12)5-8-3-4-10-11(6-8)14-7-13-10/h3-4,6H,2,5,7H2,1H3 |
CAS-nummer |
23023-13-4 |
EINECS |
245-384-2 |
Moleculaire Structuur |
|
Dichtheid |
1.175g/cm3 |
Kookpunt |
291.2°C at 760 mmHg |
Brekingsindex |
1.539 |
Vlampunt |
120.7°C |
Dampdruk |
0.00198mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|