ChemNet > CAS > 23147-58-2 glycolaldehyde dimer, mixture of stereoisomers
23147-58-2 glycolaldehyde dimer, mixture of stereoisomers
Naam product |
glycolaldehyde dimer, mixture of stereoisomers |
Engelse naam |
glycolaldehyde dimer, mixture of stereoisomers; Glycolaldehyde dimer; Hydroxy Acetaldehyde; 1,4-dioxane-2,5-diol; 2,5-Dihydroxy-1,4-dioxane |
MF |
C4H8O4 |
Molecuulgewicht |
120.1039 |
InChI |
InChI=1/C4H8O4/c5-3-1-7-4(6)2-8-3/h3-6H,1-2H2 |
CAS-nummer |
23147-58-2 |
Moleculaire Structuur |
|
Dichtheid |
1.455g/cm3 |
Smeltpunt |
85℃ |
Kookpunt |
312.4°C at 760 mmHg |
Brekingsindex |
1.513 |
Vlampunt |
142.8°C |
Dampdruk |
4.65E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|