ChemNet > CAS > 2349-58-8 4,5-Diphenyl-2-imidazolethiol
2349-58-8 4,5-Diphenyl-2-imidazolethiol
Naam product |
4,5-Diphenyl-2-imidazolethiol |
Engelse naam |
4,5-Diphenyl-2-imidazolethiol; 2,3-Diphenyl-1-indenone; 4,5-diphenyl-1,3-dihydro-2H-imidazole-2-thione |
MF |
C15H12N2S |
Molecuulgewicht |
252.3342 |
InChI |
InChI=1/C15H12N2S/c18-15-16-13(11-7-3-1-4-8-11)14(17-15)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18) |
CAS-nummer |
2349-58-8 |
EINECS |
219-077-9 |
Moleculaire Structuur |
|
Dichtheid |
1.29g/cm3 |
Smeltpunt |
300℃ |
Kookpunt |
407.5°C at 760 mmHg |
Brekingsindex |
1.724 |
Vlampunt |
200.3°C |
Dampdruk |
7.51E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|