ChemNet > CAS > 2379-55-7 2,3-Dimethylquinoxaline
2379-55-7 2,3-Dimethylquinoxaline
| Naam product |
2,3-Dimethylquinoxaline |
| Engelse naam |
2,3-Dimethylquinoxaline;Quinoxaline, 2,3-dimethyl-; 5-23-07-00267 (Beilstein Handbook Reference); BRN 0114832; NSC 1789 |
| MF |
C10H10N2 |
| Molecuulgewicht |
158.1998 |
| InChI |
InChI=1/C10H10N2/c1-7-8(2)12-10-6-4-3-5-9(10)11-7/h3-6H,1-2H3 |
| CAS-nummer |
2379-55-7 |
| EINECS |
219-162-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.109g/cm3 |
| Smeltpunt |
102-107℃ |
| Kookpunt |
257.3°C at 760 mmHg |
| Brekingsindex |
1.617 |
| Vlampunt |
105.3°C |
| Dampdruk |
0.0236mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
