ChemNet > CAS > 23806-24-8 3-Methylthiophene-2-carboxylic acid
23806-24-8 3-Methylthiophene-2-carboxylic acid
| Naam product |
3-Methylthiophene-2-carboxylic acid |
| Engelse naam |
3-Methylthiophene-2-carboxylic acid; 3-Methyl-2-thiophenecarboxylic acid; 3-methylthiophene-2-carboxylate; RARECHEM AL BO 0517; 3-Methylthiophene-2-carboxylic |
| MF |
C6H5O2S |
| Molecuulgewicht |
141.1682 |
| InChI |
InChI=1/C6H6O2S/c1-4-2-3-9-5(4)6(7)8/h2-3H,1H3,(H,7,8)/p-1 |
| CAS-nummer |
23806-24-8 |
| EINECS |
245-894-5 |
| Moleculaire Structuur |
|
| Smeltpunt |
145-146℃ |
| Kookpunt |
274°C at 760 mmHg |
| Vlampunt |
119.5°C |
| Dampdruk |
0.0027mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S24/25:;
|
|
