ChemNet > CAS > 2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
2386-26-7 ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate
| Naam product |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate |
| Engelse naam |
ethyl 4-acetyl-3,5-dimethyl-1H-pyrrole-2-carboxylate; 3-Acetyl-2,4-dimethyl-5-carbethoxypyrrole; 4-acetyl-3,5-dimethyl-1H-pyrrol-2-yl propanoate |
| MF |
C11H15NO3 |
| Molecuulgewicht |
209.2417 |
| InChI |
InChI=1/C11H15NO3/c1-5-9(14)15-11-6(2)10(8(4)13)7(3)12-11/h12H,5H2,1-4H3 |
| CAS-nummer |
2386-26-7 |
| Moleculaire Structuur |
|
| Dichtheid |
1.125g/cm3 |
| Smeltpunt |
139℃ |
| Kookpunt |
348.9°C at 760 mmHg |
| Brekingsindex |
1.517 |
| Vlampunt |
164.8°C |
| Dampdruk |
4.89E-05mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
