ChemNet > CAS > 24023-71-0 2-chloormethyl-5-(4-methoxyfenyl)-1,2,4-oxadiazol
24023-71-0 2-chloormethyl-5-(4-methoxyfenyl)-1,2,4-oxadiazol
| Naam product |
2-chloormethyl-5-(4-methoxyfenyl)-1,2,4-oxadiazol |
| Synoniemen |
2-(chloormethyl)-5-(4-methoxyfenyl)-1,3,4-oxadiazol |
| Engelse naam |
2-Chloromethyl-5-(4-methoxyphenyl)-1,2,4-oxadiazole; 2-(Chloromethyl)-5-(4-methoxyphenyl)-1,3,4-oxadiazole |
| MF |
C10H9ClN2O2 |
| Molecuulgewicht |
224.6437 |
| InChI |
InChI=1/C10H9ClN2O2/c1-14-8-4-2-7(3-5-8)10-13-12-9(6-11)15-10/h2-5H,6H2,1H3 |
| CAS-nummer |
24023-71-0 |
| Moleculaire Structuur |
|
| Dichtheid |
1.278g/cm3 |
| Smeltpunt |
91℃ |
| Kookpunt |
354.9°C at 760 mmHg |
| Brekingsindex |
1.547 |
| Vlampunt |
168.4°C |
| Dampdruk |
6.63E-05mmHg at 25°C |
| Gevaarsymbolen |
Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|