ChemNet > CAS > 2423-71-4 2,6-Dimethyl-4-nitrophenol
2423-71-4 2,6-Dimethyl-4-nitrophenol
| Naam product |
2,6-Dimethyl-4-nitrophenol |
| Engelse naam |
2,6-Dimethyl-4-nitrophenol; 4-Nitro-2,6-xylenol; 2,6-dimethyl-4-nitrophenolate |
| MF |
C8H8NO3 |
| Molecuulgewicht |
166.1546 |
| InChI |
InChI=1/C8H9NO3/c1-5-3-7(9(11)12)4-6(2)8(5)10/h3-4,10H,1-2H3/p-1 |
| CAS-nummer |
2423-71-4 |
| EINECS |
219-353-9 |
| Moleculaire Structuur |
|
| Smeltpunt |
164℃ |
| Kookpunt |
322.8°C at 760 mmHg |
| Vlampunt |
145.3°C |
| Dampdruk |
0.000145mmHg at 25°C |
| Gevaarsymbolen |
 Xi:Irritant;
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R41:Risks of serious damage to eyes.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
