2432-42-0 S-Ethyl thiopropionate
Naam product |
S-Ethyl thiopropionate |
Engelse naam |
S-Ethyl thiopropionate; Thiopropionic acid S-ethyl ester; S-ethyl propanethioate |
MF |
C5H10OS |
Molecuulgewicht |
118.1973 |
InChI |
InChI=1/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
CAS-nummer |
2432-42-0 |
EINECS |
219-405-0 |
Moleculaire Structuur |
|
Dichtheid |
0.967g/cm3 |
Kookpunt |
141.4°C at 760 mmHg |
Brekingsindex |
1.456 |
Vlampunt |
36°C |
Dampdruk |
5.87mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R10:Flammable.;
|
Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|