ChemNet > CAS > 2432-42-0 S-Ethyl thiopropionate
2432-42-0 S-Ethyl thiopropionate
| Naam product |
S-Ethyl thiopropionate |
| Engelse naam |
S-Ethyl thiopropionate; Thiopropionic acid S-ethyl ester; S-ethyl propanethioate |
| MF |
C5H10OS |
| Molecuulgewicht |
118.1973 |
| InChI |
InChI=1/C5H10OS/c1-3-5(6)7-4-2/h3-4H2,1-2H3 |
| CAS-nummer |
2432-42-0 |
| EINECS |
219-405-0 |
| Moleculaire Structuur |
|
| Dichtheid |
0.967g/cm3 |
| Kookpunt |
141.4°C at 760 mmHg |
| Brekingsindex |
1.456 |
| Vlampunt |
36°C |
| Dampdruk |
5.87mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R10:Flammable.;
|
| Veiligheid Omschrijving |
S16:Keep away from sources of ignition - No smoking.;
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|
