2436-96-6 2,2'-Dinitrobiphenyl
Naam product |
2,2'-Dinitrobiphenyl |
Engelse naam |
2,2'-Dinitrobiphenyl;2,2'-Dinitrobiphenyl, 2,2'-dinitro-; NSC 13356; 1,1'-Biphenyl, 2,2'-dinitro- (9CI); Biphenyl, 2,2'-dinitro- (8CI) |
MF |
C12H8N2O4 |
Molecuulgewicht |
244.2029 |
InChI |
InChI=1/C12H8N2O4/c15-13(16)11-7-3-1-5-9(11)10-6-2-4-8-12(10)14(17)18/h1-8H |
CAS-nummer |
2436-96-6 |
EINECS |
219-435-4 |
Moleculaire Structuur |
|
Dichtheid |
1.368g/cm3 |
Smeltpunt |
123-128℃ |
Kookpunt |
387.6°C at 760 mmHg |
Brekingsindex |
1.635 |
Vlampunt |
187.9°C |
Dampdruk |
7.25E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|