ChemNet > CAS > 244022-69-3 1-(2-chloor-6-fluorbenzyl)-1,4-diazepane
244022-69-3 1-(2-chloor-6-fluorbenzyl)-1,4-diazepane
| Naam product |
1-(2-chloor-6-fluorbenzyl)-1,4-diazepane |
| Synoniemen |
1-(2-chloor-6-fluorbenzyl)-1,4-diazeaandihydrochloride |
| Engelse naam |
1-(2-chloro-6-fluorobenzyl)-1,4-diazepane;1-(2-chloro-6-fluorobenzyl)-1,4-diazepane dihydrochloride |
| MF |
C12H18Cl3FN2 |
| Molecuulgewicht |
315.6421 |
| InChI |
InChI=1/C12H16ClFN2.2ClH/c13-11-3-1-4-12(14)10(11)9-16-7-2-5-15-6-8-16;;/h1,3-4,15H,2,5-9H2;2*1H |
| CAS-nummer |
244022-69-3 |
| Moleculaire Structuur |
|
| Kookpunt |
313.1°C at 760 mmHg |
| Vlampunt |
143.2°C |
| Dampdruk |
0.000506mmHg at 25°C |
| Gevaarsymbolen |
C:Corrosive;
|
| Risico-codes |
R34:Causes burns.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|