ChemNet > CAS > 2455-24-5 Tetrahydrofurfuryl methacrylate
2455-24-5 Tetrahydrofurfuryl methacrylate
| Naam product |
Tetrahydrofurfuryl methacrylate |
| Engelse naam |
Tetrahydrofurfuryl methacrylate; Methacrylic acid tetrahydrofurfuryl ester; tetrahydrofuran-2-ylmethyl 2-methylprop-2-enoate |
| MF |
C9H14O3 |
| Molecuulgewicht |
170.2057 |
| InChI |
InChI=1/C9H14O3/c1-7(2)9(10)12-6-8-4-3-5-11-8/h8H,1,3-6H2,2H3 |
| CAS-nummer |
2455-24-5 |
| EINECS |
219-529-5 |
| Moleculaire Structuur |
|
| Dichtheid |
1.03g/cm3 |
| Kookpunt |
265°C at 760 mmHg |
| Brekingsindex |
1.452 |
| Vlampunt |
105.6°C |
| Dampdruk |
0.0094mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S36:;
|
|
