ChemNet > CAS > 2460-59-5 3,5-Dinitro-2-hydroxybenzaldehyde
2460-59-5 3,5-Dinitro-2-hydroxybenzaldehyde
Naam product |
3,5-Dinitro-2-hydroxybenzaldehyde |
Engelse naam |
3,5-Dinitro-2-hydroxybenzaldehyde; 3,5-Dinitrosalicylaldehyde; 2-hydroxy-3,5-dinitrobenzaldehyde; 2-formyl-4,6-dinitrophenolate |
MF |
C7H3N2O6 |
Molecuulgewicht |
211.1091 |
InChI |
InChI=1/C7H4N2O6/c10-3-4-1-5(8(12)13)2-6(7(4)11)9(14)15/h1-3,11H/p-1 |
CAS-nummer |
2460-59-5 |
EINECS |
219-551-5 |
Moleculaire Structuur |
|
Kookpunt |
301.5°C at 760 mmHg |
Vlampunt |
133.3°C |
Dampdruk |
0.000585mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|