24623-20-9 6-methyl-1-indanone
Naam product |
6-methyl-1-indanone |
Engelse naam |
6-methyl-1-indanone; 6-methyl-2,3-dihydro-1H-inden-1-one |
MF |
C10H10O |
Molecuulgewicht |
146.1858 |
InChI |
InChI=1/C10H10O/c1-7-2-3-8-4-5-10(11)9(8)6-7/h2-3,6H,4-5H2,1H3 |
CAS-nummer |
24623-20-9 |
Moleculaire Structuur |
|
Dichtheid |
1.113g/cm3 |
Smeltpunt |
60-62℃ |
Kookpunt |
265.1°C at 760 mmHg |
Brekingsindex |
1.574 |
Vlampunt |
109.9°C |
Dampdruk |
0.00935mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|