ChemNet > CAS > 24673-56-1 3-Methylbenzofuran-2-carboxylic acid
24673-56-1 3-Methylbenzofuran-2-carboxylic acid
Naam product |
3-Methylbenzofuran-2-carboxylic acid |
Engelse naam |
3-Methylbenzofuran-2-carboxylic acid; 3-Methylbenzo[b]furan-2-carboxylic acid; 3-methyl-1-benzofuran-2-carboxylic acid; 3-methyl-1-benzofuran-2-carboxylate; 3-Methyl-benzofuran-2-carboxylic acid |
MF |
C10H7O3 |
Molecuulgewicht |
175.1613 |
InChI |
InChI=1/C10H8O3/c1-6-7-4-2-3-5-8(7)13-9(6)10(11)12/h2-5H,1H3,(H,11,12)/p-1 |
CAS-nummer |
24673-56-1 |
Moleculaire Structuur |
|
Smeltpunt |
192-197℃ |
Kookpunt |
328.7°C at 760 mmHg |
Vlampunt |
152.6°C |
Dampdruk |
7.53E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:;
|
|