ChemNet > CAS > 25038-71-5 poly(ethyleen-co-tetrafluorethyleen)
25038-71-5 poly(ethyleen-co-tetrafluorethyleen)
Naam product |
poly(ethyleen-co-tetrafluorethyleen) |
Synoniemen |
Tefzel; etheen, 1,1,2,2-tetrafluor-, polymeer met etheen; etheen, tetrafluor-, polymeer met etheen; etheen - tetrafluoretheen (1:1) |
Engelse naam |
poly(ethylene-co-tetrafluoroethylene);Tefzel; Ethene, 1,1,2,2-tetrafluoro-, polymer with ethene; Ethene, tetrafluoro-, polymer with ethene; ethene - tetrafluoroethene (1:1) |
MF |
C4H4F4 |
Molecuulgewicht |
128.0682 |
InChI |
InChI=1/C2F4.C2H4/c3-1(4)2(5)6;1-2/h;1-2H2 |
CAS-nummer |
25038-71-5 |
Moleculaire Structuur |
|
Dampdruk |
20000mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|