ChemNet > CAS > 25038-72-6 poly(vinylideenchloride-co-methylacrylaat)
25038-72-6 poly(vinylideenchloride-co-methylacrylaat)
Naam product |
poly(vinylideenchloride-co-methylacrylaat) |
Synoniemen |
2-propenoïnezuur, methylester, polymeer met 1,1-dichlooretheen; 1,1-dichlooretheen, methyl-2-propenoaatpolymeer; 1,1-dichlooretheen, polymeer met methyl-2-propenoaat; Vinylideenchloride, methylacrylaatpolymeer; methylprop-2-enoaat - 1,1-dichlooretheen (1:1) |
Engelse naam |
poly(vinylidene chloride-co-methyl acrylate);2-Propenoic acid, methyl ester, polymer with 1,1-dichloroethene; 1,1-Dichloroethene, methyl 2-propenoate polymer; 1,1-Dichloroethene, polymer with methyl 2-propenoate; Vinylidene chloride, methyl acrylate polymer; methyl prop-2-enoate - 1,1-dichloroethene (1:1) |
MF |
C6H8Cl2O2 |
Molecuulgewicht |
183.0325 |
InChI |
InChI=1/C4H6O2.C2H2Cl2/c1-3-4(5)6-2;1-2(3)4/h3H,1H2,2H3;1H2 |
CAS-nummer |
25038-72-6 |
Moleculaire Structuur |
|
Smeltpunt |
152℃ |
Kookpunt |
80.2°C at 760 mmHg |
Vlampunt |
6.7°C |
Dampdruk |
86.3mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|