2534-77-2 exo-2-Bromonorbornane
Naam product |
exo-2-Bromonorbornane |
Engelse naam |
exo-2-Bromonorbornane; exo-2-Bromobicyclo[2.2.1]heptane; 2-bromobicyclo[2.2.1]heptane; (2S)-2-bromobicyclo[2.2.1]heptane; (1S,2S,4R)-2-bromobicyclo[2.2.1]heptane |
MF |
C7H11Br |
Molecuulgewicht |
175.0662 |
InChI |
InChI=1/C7H11Br/c8-7-4-5-1-2-6(7)3-5/h5-7H,1-4H2/t5-,6+,7+/m1/s1 |
CAS-nummer |
2534-77-2 |
EINECS |
219-798-9 |
Moleculaire Structuur |
|
Dichtheid |
1.464g/cm3 |
Kookpunt |
183.8°C at 760 mmHg |
Brekingsindex |
1.55 |
Vlampunt |
60°C |
Dampdruk |
1.04mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|