ChemNet > CAS > 25570-02-9 3,3',5,5'-Tetramethylbiphenyl
25570-02-9 3,3',5,5'-Tetramethylbiphenyl
Naam product |
3,3',5,5'-Tetramethylbiphenyl |
Engelse naam |
3,3',5,5'-Tetramethylbiphenyl; |
MF |
C16H18 |
Molecuulgewicht |
210.3141 |
InChI |
InChI=1/C16H18/c1-11-5-12(2)8-15(7-11)16-9-13(3)6-14(4)10-16/h5-10H,1-4H3 |
CAS-nummer |
25570-02-9 |
Moleculaire Structuur |
|
Dichtheid |
0.956g/cm3 |
Kookpunt |
300.9°C at 760 mmHg |
Brekingsindex |
1.551 |
Vlampunt |
138.7°C |
Dampdruk |
0.00195mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|