ChemNet > CAS > 256383-45-6 4-n-Nonylbenzeneboronic acid
256383-45-6 4-n-Nonylbenzeneboronic acid
Naam product |
4-n-Nonylbenzeneboronic acid |
Engelse naam |
4-n-Nonylbenzeneboronic acid; 4-Nonylphenylboronicacid; (4-nonylphenyl)boronic acid; 4-N-Nonylphenylboronicacid |
MF |
C15H25BO2 |
Molecuulgewicht |
248.1688 |
InChI |
InChI=1/C15H25BO2/c1-2-3-4-5-6-7-8-9-14-10-12-15(13-11-14)16(17)18/h10-13,17-18H,2-9H2,1H3 |
CAS-nummer |
256383-45-6 |
Moleculaire Structuur |
|
Dichtheid |
0.97g/cm3 |
Kookpunt |
385.3°C at 760 mmHg |
Brekingsindex |
1.501 |
Vlampunt |
186.8°C |
Dampdruk |
1.26E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|