25928-81-8 polybenzimidazole
Naam product |
polybenzimidazole |
Engelse naam |
polybenzimidazole;1,3-Benzenedicarboxylic acid, 1,3-diphenyl ester, polymer with (1,1'-biphenyl)-3,3',4,4'-tetramine; Diphenyl isophthalate, 3,3',4,4'-tetraaminobiphenyl polymer; 1,3-Benzenedicarboxylic acid, diphenyl ester, polymer with (1,1'-biphenyl)-3,3',4,4'-tetramine; 1H-benzimidazole |
MF |
C7H6N2 |
Molecuulgewicht |
118.1359 |
InChI |
InChI=1/C7H6N2/c1-2-4-7-6(3-1)8-5-9-7/h1-5H,(H,8,9) |
CAS-nummer |
25928-81-8 |
EINECS |
200-081-4 |
Dichtheid |
1.242g/cm3 |
Kookpunt |
360°C at 760 mmHg |
Brekingsindex |
1.696 |
Vlampunt |
208.4°C |
Dampdruk |
4.74E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|