26260-02-6 2-Iodobenzaldehyde
Naam product |
2-Iodobenzaldehyde |
Engelse naam |
2-Iodobenzaldehyde; Benzaldehyde, 2-iodo- |
MF |
C7H5IO |
Molecuulgewicht |
232.0185 |
InChI |
InChI=1/C7H5IO/c8-7-4-2-1-3-6(7)5-9/h1-5H |
CAS-nummer |
26260-02-6 |
Moleculaire Structuur |
|
Dichtheid |
1.883g/cm3 |
Smeltpunt |
36-39℃ |
Kookpunt |
266.3°C at 760 mmHg |
Brekingsindex |
1.668 |
Vlampunt |
114.8°C |
Dampdruk |
0.00873mmHg at 25°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|