ChemNet > CAS > 26385-07-9 N-(2-Chloroethyl)benzamide
26385-07-9 N-(2-Chloroethyl)benzamide
Naam product |
N-(2-Chloroethyl)benzamide |
Engelse naam |
N-(2-Chloroethyl)benzamide; |
MF |
C9H10ClNO |
Molecuulgewicht |
183.6348 |
InChI |
InChI=1/C9H10ClNO/c10-6-7-11-9(12)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,11,12) |
CAS-nummer |
26385-07-9 |
EINECS |
247-641-4 |
Moleculaire Structuur |
|
Dichtheid |
1.164g/cm3 |
Smeltpunt |
102-106℃ |
Kookpunt |
366.4°C at 760 mmHg |
Brekingsindex |
1.538 |
Vlampunt |
175.4°C |
Dampdruk |
1.47E-05mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|