ChemNet > CAS > 26663-77-4 methyl 1H-benzimidazole-5-carboxylate
26663-77-4 methyl 1H-benzimidazole-5-carboxylate
Naam product |
methyl 1H-benzimidazole-5-carboxylate |
Engelse naam |
methyl 1H-benzimidazole-5-carboxylate; 1H-Benzimidazole-5-carboxylic acid methyl ester; methyl 1H-benzimidazole-6-carboxylate |
MF |
C9H8N2O2 |
Molecuulgewicht |
176.172 |
InChI |
InChI=1/C9H8N2O2/c1-13-9(12)6-2-3-7-8(4-6)11-5-10-7/h2-5H,1H3,(H,10,11) |
CAS-nummer |
26663-77-4 |
Moleculaire Structuur |
|
Dichtheid |
1.324g/cm3 |
Kookpunt |
416.2°C at 760 mmHg |
Brekingsindex |
1.648 |
Vlampunt |
205.5°C |
Dampdruk |
3.9E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|