Naam product |
Formaldehyde, oligomere reactieproducten met 5,5-dimethyl-2,4-imidazolidinedion |
Synoniemen |
Dimethylhydantoïneformaldehydehars; 2,4-imidazoolidinedion, dimethyl-, polymeer met formaldehyde; DMHF; Dimethylhydantoïne-formaldehydehars; Formaldehyde, polymeer met 5,5-dimethyl-2,4-imidazolidinedion; 5,5-dimethylimidazolidine-2,4-dion - formaldehyde (1:1) |
Engelse naam |
Formaldehyde, oligomeric reaction products with 5,5-dimethyl-2,4-imidazolidinedione;Dimethyl hydantoin formaldehyde resin; 2,4-Imidazolidinedione, dimethyl-, polymer with formaldehyde; DMHF; Dimethylhydantoin-formaldehyde resin; Formaldehyde, polymer with 5,5-dimethyl-2,4-imidazolidinedione; 5,5-dimethylimidazolidine-2,4-dione - formaldehyde (1:1) |
MF |
C6H10N2O3 |
Molecuulgewicht |
158.1552 |
InChI |
InChI=1/C5H8N2O2.CH2O/c1-5(2)3(8)6-4(9)7-5;1-2/h1-2H3,(H2,6,7,8,9);1H2 |
CAS-nummer |
26811-08-5 |
EINECS |
500-052-9 |
Moleculaire Structuur |
|
Kookpunt |
244.1°C at 760 mmHg |
Vlampunt |
106.6°C |
Dampdruk |
0.031mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
|
|