ChemNet > CAS > 2694-54-4 Triallyl Trimellitate
2694-54-4 Triallyl Trimellitate
| Naam product |
Triallyl Trimellitate |
| Engelse naam |
Triallyl Trimellitate; 1,2,4-Benzenetricarboxylic acid triallyl ester; Trimellitic acid triallyl ester; triprop-2-en-1-yl benzene-1,2,4-tricarboxylate |
| MF |
C18H18O6 |
| Molecuulgewicht |
330.3319 |
| InChI |
InChI=1/C18H18O6/c1-4-9-22-16(19)13-7-8-14(17(20)23-10-5-2)15(12-13)18(21)24-11-6-3/h4-8,12H,1-3,9-11H2 |
| CAS-nummer |
2694-54-4 |
| EINECS |
220-264-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.149g/cm3 |
| Kookpunt |
438.1°C at 760 mmHg |
| Brekingsindex |
1.528 |
| Vlampunt |
191.3°C |
| Dampdruk |
7.07E-08mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/38:Irritating to eyes and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
