26964-24-9 6-Methoxyflavone
Naam product |
6-Methoxyflavone |
Engelse naam |
6-Methoxyflavone;5-18-02-00257 (Beilstein Handbook Reference); 6-Methoxy-2-phenyl-4H-1-benzopyran-4-one; BRN 0218520; 4H-1-Benzopyran-4-one, 6-methoxy-2-phenyl-; 6-Methoxy-2-phenyl-4-benzopyrone; Flavone, 6-methoxy- (7CI,8CI); 6-methoxy-2-phenyl-4H-chromen-4-one |
MF |
C16H12O3 |
Molecuulgewicht |
252.2647 |
InChI |
InChI=1/C16H12O3/c1-18-12-7-8-15-13(9-12)14(17)10-16(19-15)11-5-3-2-4-6-11/h2-10H,1H3 |
CAS-nummer |
26964-24-9 |
EINECS |
248-144-5 |
Moleculaire Structuur |
|
Dichtheid |
1.24g/cm3 |
Smeltpunt |
163-165℃ |
Kookpunt |
421.2°C at 760 mmHg |
Brekingsindex |
1.614 |
Vlampunt |
200.3°C |
Dampdruk |
2.66E-07mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|