ChemNet > CAS > 2700-22-3 Benzylidenemalononitrile
2700-22-3 Benzylidenemalononitrile
| Naam product |
Benzylidenemalononitrile |
| Engelse naam |
Benzylidenemalononitrile; beta,beta-styrenedicarbonitrile; Benzalmalononitrile; 2-benzylidenemalononitrile; benzylidenepropanedinitrile |
| MF |
C10H6N2 |
| Molecuulgewicht |
154.168 |
| InChI |
InChI=1/C10H6N2/c11-7-10(8-12)6-9-4-2-1-3-5-9/h1-6H |
| CAS-nummer |
2700-22-3 |
| EINECS |
220-283-6 |
| Moleculaire Structuur |
|
| Dichtheid |
1.154g/cm3 |
| Smeltpunt |
82-86℃ |
| Kookpunt |
294.8°C at 760 mmHg |
| Brekingsindex |
1.612 |
| Vlampunt |
138°C |
| Dampdruk |
0.00159mmHg at 25°C |
| Gevaarsymbolen |
 T:Toxic;
|
| Risico-codes |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| Veiligheid Omschrijving |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
