ChemNet > CAS > 27129-87-9 3,5-dimethylbenzyl alcohol
27129-87-9 3,5-dimethylbenzyl alcohol
| Naam product |
3,5-dimethylbenzyl alcohol |
| Engelse naam |
3,5-dimethylbenzyl alcohol; 3,5-Dimethylbenzylalcohol; (3,5-dimethylphenyl)methanol |
| MF |
C9H12O |
| Molecuulgewicht |
136.191 |
| InChI |
InChI=1/C9H12O/c1-7-3-8(2)5-9(4-7)6-10/h3-5,10H,6H2,1-2H3 |
| CAS-nummer |
27129-87-9 |
| EINECS |
248-241-2 |
| Moleculaire Structuur |
|
| Dichtheid |
1.002g/cm3 |
| Kookpunt |
219.5°C at 760 mmHg |
| Brekingsindex |
1.536 |
| Vlampunt |
106.7°C |
| Dampdruk |
0.0689mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
|
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|
