ChemNet > CAS > 2719-21-3 4-Acetamido-acetophenone
2719-21-3 4-Acetamido-acetophenone
Naam product |
4-Acetamido-acetophenone |
Engelse naam |
4-Acetamido-acetophenone; 4-Acetylacetanilide~N,4-Diacetylaniline; 4-Acetamidoacetophenone; N-(4-acetylphenyl)acetamide |
MF |
C10H11NO2 |
Molecuulgewicht |
177.1998 |
InChI |
InChI=1/C10H11NO2/c1-7(12)9-3-5-10(6-4-9)11-8(2)13/h3-6H,1-2H3,(H,11,13) |
CAS-nummer |
2719-21-3 |
EINECS |
220-320-6 |
Moleculaire Structuur |
|
Dichtheid |
1.15g/cm3 |
Smeltpunt |
164-166℃ |
Kookpunt |
390.3°C at 760 mmHg |
Brekingsindex |
1.57 |
Vlampunt |
177.3°C |
Dampdruk |
2.67E-06mmHg at 25°C |
Gevaarsymbolen |
|
Risico-codes |
|
Veiligheid Omschrijving |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|