ChemNet > CAS > 27339-38-4 3-Formylfuran-2-boronic acid
27339-38-4 3-Formylfuran-2-boronic acid
| Naam product |
3-Formylfuran-2-boronic acid |
| Engelse naam |
3-Formylfuran-2-boronic acid; 2-Borono-3-furaldehyde; (3-formylfuran-2-yl)boronic acid |
| MF |
C5H5BO4 |
| Molecuulgewicht |
139.9018 |
| InChI |
InChI=1/C5H5BO4/c7-3-4-1-2-10-5(4)6(8)9/h1-3,8-9H |
| CAS-nummer |
27339-38-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.36g/cm3 |
| Kookpunt |
346.6°C at 760 mmHg |
| Brekingsindex |
1.51 |
| Vlampunt |
163.4°C |
| Dampdruk |
2.15E-05mmHg at 25°C |
| Gevaarsymbolen |
|
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
